C23H30FN3O4 — CID 144629740
acetic acid;5-fluoro-2-methoxy-4-[4-(4-pyrrolidin-1-ylphenoxy)piperidin-1-yl]pyridine (PubChem CID 144629740) has the molecular formula C23H30FN3O4 and a molecular weight of 431.51 g/mol. Its IUPAC name is acetic acid;5-fluoro-2-methoxy-4-[4-(4-pyrrolidin-1-ylphenoxy)piperidin-1-yl]pyridine.
| Compound Name | acetic acid;5-fluoro-2-methoxy-4-[4-(4-pyrrolidin-1-ylphenoxy)piperidin-1-yl]pyridine |
|---|---|
| PubChem CID | 144629740 |
| Molecular Formula | C23H30FN3O4 |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | acetic acid;5-fluoro-2-methoxy-4-[4-(4-pyrrolidin-1-ylphenoxy)piperidin-1-yl]pyridine |
| SMILES | CC(=O)O.COc1cc(N2CCC(Oc3ccc(N4CCCC4)cc3)CC2)c(F)cn1 |
| InChI | InChI=1S/C21H26FN3O2.C2H4O2/c1-26-21-14-20(19(22)15-23-21)25-12-8-18(9-13-25)27-17-6-4-16(5-7-17)24-10-2-3-11-24;1-2(3)4/h4-7,14-15,18H,2-3,8-13H2,1H3;1H3,(H,3,4) |
| InChIKey | QNHVFFKKLFKWAG-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 75.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|