C11H21N3 — CID 134406057
N-ethyl-N'-methyl-N'-[(5-methyl-1H-pyrrol-2-yl)methyl]ethane-1,2-diamine (PubChem CID 134406057) has the molecular formula C11H21N3 and a molecular weight of 195.31 g/mol. Its IUPAC name is N-ethyl-N'-methyl-N'-[(5-methyl-1H-pyrrol-2-yl)methyl]ethane-1,2-diamine.
| Compound Name | N-ethyl-N'-methyl-N'-[(5-methyl-1H-pyrrol-2-yl)methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 134406057 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | N-ethyl-N'-methyl-N'-[(5-methyl-1H-pyrrol-2-yl)methyl]ethane-1,2-diamine |
| SMILES | CCNCCN(C)Cc1ccc(C)[nH]1 |
| InChI | InChI=1S/C11H21N3/c1-4-12-7-8-14(3)9-11-6-5-10(2)13-11/h5-6,12-13H,4,7-9H2,1-3H3 |
| InChIKey | KXQYKOJKWUXUOP-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 31.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|