C17H19N5O2S — CID 134407741
1-(3-cyano-1-methylcyclobutyl)-3-(4-methylsulfinylanilino)pyrazole-4-carboxamide (PubChem CID 134407741) has the molecular formula C17H19N5O2S and a molecular weight of 357.44 g/mol. Its IUPAC name is 1-(3-cyano-1-methylcyclobutyl)-3-(4-methylsulfinylanilino)pyrazole-4-carboxamide.
| Compound Name | 1-(3-cyano-1-methylcyclobutyl)-3-(4-methylsulfinylanilino)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 134407741 |
| Molecular Formula | C17H19N5O2S |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 1-(3-cyano-1-methylcyclobutyl)-3-(4-methylsulfinylanilino)pyrazole-4-carboxamide |
| SMILES | CS(=O)c1ccc(Nc2nn(C3(C)CC(C#N)C3)cc2C(N)=O)cc1 |
| InChI | InChI=1S/C17H19N5O2S/c1-17(7-11(8-17)9-18)22-10-14(15(19)23)16(21-22)20-12-3-5-13(6-4-12)25(2)24/h3-6,10-11H,7-8H2,1-2H3,(H2,19,23)(H,20,21) |
| InChIKey | NNNKGGWAHLKXQZ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 113.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |