C16H14N2S — CID 134409661
6,6-dimethyl-9-thia-1,11-diazatetracyclo[8.7.0.02,8.012,17]heptadeca-2,4,7,10,12,14,16-heptaene (PubChem CID 134409661) has the molecular formula C16H14N2S and a molecular weight of 266.37 g/mol. Its IUPAC name is 6,6-dimethyl-9-thia-1,11-diazatetracyclo[8.7.0.02,8.012,17]heptadeca-2,4,7,10,12,14,16-heptaene.
| Compound Name | 6,6-dimethyl-9-thia-1,11-diazatetracyclo[8.7.0.02,8.012,17]heptadeca-2,4,7,10,12,14,16-heptaene |
|---|---|
| PubChem CID | 134409661 |
| Molecular Formula | C16H14N2S |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 6,6-dimethyl-9-thia-1,11-diazatetracyclo[8.7.0.02,8.012,17]heptadeca-2,4,7,10,12,14,16-heptaene |
| SMILES | CC1(C)C=CC=c2c(sc3nc4ccccc4n23)=C1 |
| InChI | InChI=1S/C16H14N2S/c1-16(2)9-5-8-13-14(10-16)19-15-17-11-6-3-4-7-12(11)18(13)15/h3-10H,1-2H3 |
| InChIKey | JTEXZEHMPDQLPN-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |