C20H16F6N2O3 — CID 134411737
(3S,4S)-1-methyl-2-oxo-4-[3-(trifluoromethoxy)phenyl]-N-(2,3,4-trifluorophenyl)piperidine-3-carboxamide (PubChem CID 134411737) has the molecular formula C20H16F6N2O3 and a molecular weight of 446.35 g/mol. Its IUPAC name is (3S,4S)-1-methyl-2-oxo-4-[3-(trifluoromethoxy)phenyl]-N-(2,3,4-trifluorophenyl)piperidine-3-carboxamide.
| Compound Name | (3S,4S)-1-methyl-2-oxo-4-[3-(trifluoromethoxy)phenyl]-N-(2,3,4-trifluorophenyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 134411737 |
| Molecular Formula | C20H16F6N2O3 |
| Molecular Weight | 446.35 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | (3S,4S)-1-methyl-2-oxo-4-[3-(trifluoromethoxy)phenyl]-N-(2,3,4-trifluorophenyl)piperidine-3-carboxamide |
| SMILES | CN1CC[C@H](c2cccc(OC(F)(F)F)c2)[C@@H](C(=O)Nc2ccc(F)c(F)c2F)C1=O |
| InChI | InChI=1S/C20H16F6N2O3/c1-28-8-7-12(10-3-2-4-11(9-10)31-20(24,25)26)15(19(28)30)18(29)27-14-6-5-13(21)16(22)17(14)23/h2-6,9,12,15H,7-8H2,1H3,(H,27,29)/t12-,15+/m1/s1 |
| InChIKey | QIAFYNYVTQSJJY-DOMZBBRYSA-N |
| XLogP | 4.20 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.35 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|