C20H21F3N4O2 — CID 134412509
(3S,4R)-4-(6-tert-butylpyrimidin-4-yl)-1-methyl-2-oxo-N-(2,3,4-trifluorophenyl)pyrrolidine-3-carboxamide (PubChem CID 134412509) has the molecular formula C20H21F3N4O2 and a molecular weight of 406.41 g/mol. Its IUPAC name is (3S,4R)-4-(6-tert-butylpyrimidin-4-yl)-1-methyl-2-oxo-N-(2,3,4-trifluorophenyl)pyrrolidine-3-carboxamide.
| Compound Name | (3S,4R)-4-(6-tert-butylpyrimidin-4-yl)-1-methyl-2-oxo-N-(2,3,4-trifluorophenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 134412509 |
| Molecular Formula | C20H21F3N4O2 |
| Molecular Weight | 406.41 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | (3S,4R)-4-(6-tert-butylpyrimidin-4-yl)-1-methyl-2-oxo-N-(2,3,4-trifluorophenyl)pyrrolidine-3-carboxamide |
| SMILES | CN1C[C@H](c2cc(C(C)(C)C)ncn2)[C@@H](C(=O)Nc2ccc(F)c(F)c2F)C1=O |
| InChI | InChI=1S/C20H21F3N4O2/c1-20(2,3)14-7-13(24-9-25-14)10-8-27(4)19(29)15(10)18(28)26-12-6-5-11(21)16(22)17(12)23/h5-7,9-10,15H,8H2,1-4H3,(H,26,28)/t10-,15+/m1/s1 |
| InChIKey | VIKWVNSYCCHMRE-BMIGLBTASA-N |
| XLogP | 3.00 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.41 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|