C20H17F5N2O2S — CID 134412230
(3S,4S)-4-(6,6-difluoro-5,7-dihydro-4H-1-benzothiophen-3-yl)-1-methyl-2-oxo-N-(2,3,4-trifluorophenyl)pyrrolidine-3-carboxamide (PubChem CID 134412230) has the molecular formula C20H17F5N2O2S and a molecular weight of 444.43 g/mol. Its IUPAC name is (3S,4S)-4-(6,6-difluoro-5,7-dihydro-4H-1-benzothiophen-3-yl)-1-methyl-2-oxo-N-(2,3,4-trifluorophenyl)pyrrolidine-3-carboxamide.
| Compound Name | (3S,4S)-4-(6,6-difluoro-5,7-dihydro-4H-1-benzothiophen-3-yl)-1-methyl-2-oxo-N-(2,3,4-trifluorophenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 134412230 |
| Molecular Formula | C20H17F5N2O2S |
| Molecular Weight | 444.43 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | (3S,4S)-4-(6,6-difluoro-5,7-dihydro-4H-1-benzothiophen-3-yl)-1-methyl-2-oxo-N-(2,3,4-trifluorophenyl)pyrrolidine-3-carboxamide |
| SMILES | CN1C[C@H](c2csc3c2CCC(F)(F)C3)[C@@H](C(=O)Nc2ccc(F)c(F)c2F)C1=O |
| InChI | InChI=1S/C20H17F5N2O2S/c1-27-7-10(11-8-30-14-6-20(24,25)5-4-9(11)14)15(19(27)29)18(28)26-13-3-2-12(21)16(22)17(13)23/h2-3,8,10,15H,4-7H2,1H3,(H,26,28)/t10-,15+/m1/s1 |
| InChIKey | UEAQUWQLNCIVFW-BMIGLBTASA-N |
| XLogP | 4.10 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.43 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|