C17H14F6N4OS — CID 155024424
(3S,4S)-1-methyl-4-[1-methyl-5-(trifluoromethyl)pyrazol-4-yl]-2-sulfanylidene-N-(2,3,4-trifluorophenyl)pyrrolidine-3-carboxamide (PubChem CID 155024424) has the molecular formula C17H14F6N4OS and a molecular weight of 436.38 g/mol. Its IUPAC name is (3S,4S)-1-methyl-4-[1-methyl-5-(trifluoromethyl)pyrazol-4-yl]-2-sulfanylidene-N-(2,3,4-trifluorophenyl)pyrrolidine-3-carboxamide.
| Compound Name | (3S,4S)-1-methyl-4-[1-methyl-5-(trifluoromethyl)pyrazol-4-yl]-2-sulfanylidene-N-(2,3,4-trifluorophenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 155024424 |
| Molecular Formula | C17H14F6N4OS |
| Molecular Weight | 436.38 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | (3S,4S)-1-methyl-4-[1-methyl-5-(trifluoromethyl)pyrazol-4-yl]-2-sulfanylidene-N-(2,3,4-trifluorophenyl)pyrrolidine-3-carboxamide |
| SMILES | CN1C[C@H](c2cnn(C)c2C(F)(F)F)[C@@H](C(=O)Nc2ccc(F)c(F)c2F)C1=S |
| InChI | InChI=1S/C17H14F6N4OS/c1-26-6-8(7-5-24-27(2)14(7)17(21,22)23)11(16(26)29)15(28)25-10-4-3-9(18)12(19)13(10)20/h3-5,8,11H,6H2,1-2H3,(H,25,28)/t8-,11+/m1/s1 |
| InChIKey | NZORXJAFPIIMHY-KCJUWKMLSA-N |
| XLogP | 3.47 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.38 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|