C15H24N4O3 — CID 134413919
tert-butyl 6-[4-(2-hydroxyethyl)piperazin-1-yl]pyridazine-3-carboxylate (PubChem CID 134413919) has the molecular formula C15H24N4O3 and a molecular weight of 308.38 g/mol. Its IUPAC name is tert-butyl 6-[4-(2-hydroxyethyl)piperazin-1-yl]pyridazine-3-carboxylate.
| Compound Name | tert-butyl 6-[4-(2-hydroxyethyl)piperazin-1-yl]pyridazine-3-carboxylate |
|---|---|
| PubChem CID | 134413919 |
| Molecular Formula | C15H24N4O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | tert-butyl 6-[4-(2-hydroxyethyl)piperazin-1-yl]pyridazine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1ccc(N2CCN(CCO)CC2)nn1 |
| InChI | InChI=1S/C15H24N4O3/c1-15(2,3)22-14(21)12-4-5-13(17-16-12)19-8-6-18(7-9-19)10-11-20/h4-5,20H,6-11H2,1-3H3 |
| InChIKey | SRELSLZNBQZCDE-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |