C26H40N2O4 — CID 134414352
tert-butyl (3S,5R)-4-[(E)-6-(4-ethoxycarbonylphenyl)hex-5-enyl]-3,5-dimethylpiperazine-1-carboxylate (PubChem CID 134414352) has the molecular formula C26H40N2O4 and a molecular weight of 444.62 g/mol. Its IUPAC name is tert-butyl (3S,5R)-4-[(E)-6-(4-ethoxycarbonylphenyl)hex-5-enyl]-3,5-dimethylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (3S,5R)-4-[(E)-6-(4-ethoxycarbonylphenyl)hex-5-enyl]-3,5-dimethylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 134414352 |
| Molecular Formula | C26H40N2O4 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.30 |
| IUPAC Name | tert-butyl (3S,5R)-4-[(E)-6-(4-ethoxycarbonylphenyl)hex-5-enyl]-3,5-dimethylpiperazine-1-carboxylate |
| SMILES | CCOC(=O)c1ccc(/C=C/CCCCN2[C@H](C)CN(C(=O)OC(C)(C)C)C[C@@H]2C)cc1 |
| InChI | InChI=1S/C26H40N2O4/c1-7-31-24(29)23-15-13-22(14-16-23)12-10-8-9-11-17-28-20(2)18-27(19-21(28)3)25(30)32-26(4,5)6/h10,12-16,20-21H,7-9,11,17-19H2,1-6H3/b12-10+/t20-,21+ |
| InChIKey | DYRCROZTEJBVTE-QFANGBHBSA-N |
| XLogP | 5.38 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|