C17H21F3N2 — CID 134415080
2,6-ditert-butyl-3-(trifluoromethyl)quinoxaline (PubChem CID 134415080) has the molecular formula C17H21F3N2 and a molecular weight of 310.36 g/mol. Its IUPAC name is 2,6-ditert-butyl-3-(trifluoromethyl)quinoxaline.
| Compound Name | 2,6-ditert-butyl-3-(trifluoromethyl)quinoxaline |
|---|---|
| PubChem CID | 134415080 |
| Molecular Formula | C17H21F3N2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 2,6-ditert-butyl-3-(trifluoromethyl)quinoxaline |
| SMILES | CC(C)(C)c1ccc2nc(C(C)(C)C)c(C(F)(F)F)nc2c1 |
| InChI | InChI=1S/C17H21F3N2/c1-15(2,3)10-7-8-11-12(9-10)22-14(17(18,19)20)13(21-11)16(4,5)6/h7-9H,1-6H3 |
| InChIKey | BTXCHDZPDYGDPU-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |