C18H18F3N3O2 — CID 134416122
(3R,4R)-N-(2,3-difluorophenyl)-4-(5-fluoro-3-methyl-4H-pyridin-3-yl)-1-methyl-2-oxopyrrolidine-3-carboxamide (PubChem CID 134416122) has the molecular formula C18H18F3N3O2 and a molecular weight of 365.36 g/mol. Its IUPAC name is (3R,4R)-N-(2,3-difluorophenyl)-4-(5-fluoro-3-methyl-4H-pyridin-3-yl)-1-methyl-2-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R,4R)-N-(2,3-difluorophenyl)-4-(5-fluoro-3-methyl-4H-pyridin-3-yl)-1-methyl-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 134416122 |
| Molecular Formula | C18H18F3N3O2 |
| Molecular Weight | 365.36 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | (3R,4R)-N-(2,3-difluorophenyl)-4-(5-fluoro-3-methyl-4H-pyridin-3-yl)-1-methyl-2-oxopyrrolidine-3-carboxamide |
| SMILES | CN1C[C@@H](C2(C)C=NC=C(F)C2)[C@H](C(=O)Nc2cccc(F)c2F)C1=O |
| InChI | InChI=1S/C18H18F3N3O2/c1-18(6-10(19)7-22-9-18)11-8-24(2)17(26)14(11)16(25)23-13-5-3-4-12(20)15(13)21/h3-5,7,9,11,14H,6,8H2,1-2H3,(H,23,25)/t11-,14-,18?/m1/s1 |
| InChIKey | PMJDVBXYKFIHPP-XXHWGDKOSA-N |
| XLogP | 2.90 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.36 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|