C19H13NO4 — CID 134416470
1-(3-carboxy-1H-inden-5-yl)indole-2-carboxylic acid (PubChem CID 134416470) has the molecular formula C19H13NO4 and a molecular weight of 319.32 g/mol. Its IUPAC name is 1-(3-carboxy-1H-inden-5-yl)indole-2-carboxylic acid.
| Compound Name | 1-(3-carboxy-1H-inden-5-yl)indole-2-carboxylic acid |
|---|---|
| PubChem CID | 134416470 |
| Molecular Formula | C19H13NO4 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 1-(3-carboxy-1H-inden-5-yl)indole-2-carboxylic acid |
| SMILES | O=C(O)C1=CCc2ccc(-n3c(C(=O)O)cc4ccccc43)cc21 |
| InChI | InChI=1S/C19H13NO4/c21-18(22)14-8-6-11-5-7-13(10-15(11)14)20-16-4-2-1-3-12(16)9-17(20)19(23)24/h1-5,7-10H,6H2,(H,21,22)(H,23,24) |
| InChIKey | IFKXLDSKRNUJIH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |