C21H18N4O — CID 159247569
N,1-bis(4-aminophenyl)indole-2-carboxamide (PubChem CID 159247569) has the molecular formula C21H18N4O and a molecular weight of 342.40 g/mol. Its IUPAC name is N,1-bis(4-aminophenyl)indole-2-carboxamide.
| Compound Name | N,1-bis(4-aminophenyl)indole-2-carboxamide |
|---|---|
| PubChem CID | 159247569 |
| Molecular Formula | C21H18N4O |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | N,1-bis(4-aminophenyl)indole-2-carboxamide |
| SMILES | Nc1ccc(NC(=O)c2cc3ccccc3n2-c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C21H18N4O/c22-15-5-9-17(10-6-15)24-21(26)20-13-14-3-1-2-4-19(14)25(20)18-11-7-16(23)8-12-18/h1-13H,22-23H2,(H,24,26) |
| InChIKey | MSIKFCQJAAWLDM-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 86.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|