C21H14F4N4O — CID 174549252
5-amino-2-fluoro-N-[4-[2-(trifluoromethyl)benzimidazol-1-yl]phenyl]benzamide (PubChem CID 174549252) has the molecular formula C21H14F4N4O and a molecular weight of 414.36 g/mol. Its IUPAC name is 5-amino-2-fluoro-N-[4-[2-(trifluoromethyl)benzimidazol-1-yl]phenyl]benzamide.
| Compound Name | 5-amino-2-fluoro-N-[4-[2-(trifluoromethyl)benzimidazol-1-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 174549252 |
| Molecular Formula | C21H14F4N4O |
| Molecular Weight | 414.36 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | 5-amino-2-fluoro-N-[4-[2-(trifluoromethyl)benzimidazol-1-yl]phenyl]benzamide |
| SMILES | Nc1ccc(F)c(C(=O)Nc2ccc(-n3c(C(F)(F)F)nc4ccccc43)cc2)c1 |
| InChI | InChI=1S/C21H14F4N4O/c22-16-10-5-12(26)11-15(16)19(30)27-13-6-8-14(9-7-13)29-18-4-2-1-3-17(18)28-20(29)21(23,24)25/h1-11H,26H2,(H,27,30) |
| InChIKey | NQBOKRSRFQQUIY-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.36 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|