C21H11F4N7O2 — CID 143549955
1-[4-[(3-fluoropyridine-4-carbonyl)amino]phenyl]-2-(trifluoromethyl)benzimidazole-5-carbonyl azide (PubChem CID 143549955) has the molecular formula C21H11F4N7O2 and a molecular weight of 469.36 g/mol. Its IUPAC name is 1-[4-[(3-fluoropyridine-4-carbonyl)amino]phenyl]-2-(trifluoromethyl)benzimidazole-5-carbonyl azide.
| Compound Name | 1-[4-[(3-fluoropyridine-4-carbonyl)amino]phenyl]-2-(trifluoromethyl)benzimidazole-5-carbonyl azide |
|---|---|
| PubChem CID | 143549955 |
| Molecular Formula | C21H11F4N7O2 |
| Molecular Weight | 469.36 g/mol |
| Exact Mass | 469.09 |
| IUPAC Name | 1-[4-[(3-fluoropyridine-4-carbonyl)amino]phenyl]-2-(trifluoromethyl)benzimidazole-5-carbonyl azide |
| SMILES | [N-]=[N+]=NC(=O)c1ccc2c(c1)nc(C(F)(F)F)n2-c1ccc(NC(=O)c2ccncc2F)cc1 |
| InChI | InChI=1S/C21H11F4N7O2/c22-15-10-27-8-7-14(15)19(34)28-12-2-4-13(5-3-12)32-17-6-1-11(18(33)30-31-26)9-16(17)29-20(32)21(23,24)25/h1-10H,(H,28,34) |
| InChIKey | UUAOUFCGNLEQLF-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 125.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.36 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|