C20H14F3N3O3 — CID 59296731
N-[4-[5-methoxy-2-(trifluoromethyl)benzimidazol-1-yl]phenyl]furan-2-carboxamide (PubChem CID 59296731) has the molecular formula C20H14F3N3O3 and a molecular weight of 401.34 g/mol. Its IUPAC name is N-[4-[5-methoxy-2-(trifluoromethyl)benzimidazol-1-yl]phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[5-methoxy-2-(trifluoromethyl)benzimidazol-1-yl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 59296731 |
| Molecular Formula | C20H14F3N3O3 |
| Molecular Weight | 401.34 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | N-[4-[5-methoxy-2-(trifluoromethyl)benzimidazol-1-yl]phenyl]furan-2-carboxamide |
| SMILES | COc1ccc2c(c1)nc(C(F)(F)F)n2-c1ccc(NC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C20H14F3N3O3/c1-28-14-8-9-16-15(11-14)25-19(20(21,22)23)26(16)13-6-4-12(5-7-13)24-18(27)17-3-2-10-29-17/h2-11H,1H3,(H,24,27) |
| InChIKey | PADGSVTYKJKTQF-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.34 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |