C23H17F3N4O4 — CID 143205821
N-[4-[5-methoxy-2-(2,2,2-trifluoroethyl)benzimidazol-1-yl]phenyl]-2-nitrobenzamide (PubChem CID 143205821) has the molecular formula C23H17F3N4O4 and a molecular weight of 470.41 g/mol. Its IUPAC name is N-[4-[5-methoxy-2-(2,2,2-trifluoroethyl)benzimidazol-1-yl]phenyl]-2-nitrobenzamide.
| Compound Name | N-[4-[5-methoxy-2-(2,2,2-trifluoroethyl)benzimidazol-1-yl]phenyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 143205821 |
| Molecular Formula | C23H17F3N4O4 |
| Molecular Weight | 470.41 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | N-[4-[5-methoxy-2-(2,2,2-trifluoroethyl)benzimidazol-1-yl]phenyl]-2-nitrobenzamide |
| SMILES | COc1ccc2c(c1)nc(CC(F)(F)F)n2-c1ccc(NC(=O)c2ccccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H17F3N4O4/c1-34-16-10-11-20-18(12-16)28-21(13-23(24,25)26)29(20)15-8-6-14(7-9-15)27-22(31)17-4-2-3-5-19(17)30(32)33/h2-12H,13H2,1H3,(H,27,31) |
| InChIKey | KLHKLWYYFKSMJG-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.41 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|