C23H28ClN3O2 — CID 172769945
1-(4-chlorophenyl)indole-2-carboxylic acid;1-propan-2-ylpiperidin-4-amine (PubChem CID 172769945) has the molecular formula C23H28ClN3O2 and a molecular weight of 413.95 g/mol. Its IUPAC name is 1-(4-chlorophenyl)indole-2-carboxylic acid;1-propan-2-ylpiperidin-4-amine.
| Compound Name | 1-(4-chlorophenyl)indole-2-carboxylic acid;1-propan-2-ylpiperidin-4-amine |
|---|---|
| PubChem CID | 172769945 |
| Molecular Formula | C23H28ClN3O2 |
| Molecular Weight | 413.95 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | 1-(4-chlorophenyl)indole-2-carboxylic acid;1-propan-2-ylpiperidin-4-amine |
| SMILES | CC(C)N1CCC(N)CC1.O=C(O)c1cc2ccccc2n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H10ClNO2.C8H18N2/c16-11-5-7-12(8-6-11)17-13-4-2-1-3-10(13)9-14(17)15(18)19;1-7(2)10-5-3-8(9)4-6-10/h1-9H,(H,18,19);7-8H,3-6,9H2,1-2H3 |
| InChIKey | MUYLFCNXISOLHE-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 71.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.95 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |