C25H23ClN4O — CID 20801068
[1-(4-chlorophenyl)indol-2-yl]-[4-(pyridin-4-ylamino)piperidin-1-yl]methanone (PubChem CID 20801068) has the molecular formula C25H23ClN4O and a molecular weight of 430.94 g/mol. Its IUPAC name is [1-(4-chlorophenyl)indol-2-yl]-[4-(pyridin-4-ylamino)piperidin-1-yl]methanone.
| Compound Name | [1-(4-chlorophenyl)indol-2-yl]-[4-(pyridin-4-ylamino)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 20801068 |
| Molecular Formula | C25H23ClN4O |
| Molecular Weight | 430.94 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | [1-(4-chlorophenyl)indol-2-yl]-[4-(pyridin-4-ylamino)piperidin-1-yl]methanone |
| SMILES | O=C(c1cc2ccccc2n1-c1ccc(Cl)cc1)N1CCC(Nc2ccncc2)CC1 |
| InChI | InChI=1S/C25H23ClN4O/c26-19-5-7-22(8-6-19)30-23-4-2-1-3-18(23)17-24(30)25(31)29-15-11-21(12-16-29)28-20-9-13-27-14-10-20/h1-10,13-14,17,21H,11-12,15-16H2,(H,27,28) |
| InChIKey | MBCHAYXMMIDQEC-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.94 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |