C23H26ClN3O — CID 20801044
[1-(3-chlorophenyl)indol-2-yl]-[4-(propan-2-ylamino)piperidin-1-yl]methanone (PubChem CID 20801044) has the molecular formula C23H26ClN3O and a molecular weight of 395.93 g/mol. Its IUPAC name is [1-(3-chlorophenyl)indol-2-yl]-[4-(propan-2-ylamino)piperidin-1-yl]methanone.
| Compound Name | [1-(3-chlorophenyl)indol-2-yl]-[4-(propan-2-ylamino)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 20801044 |
| Molecular Formula | C23H26ClN3O |
| Molecular Weight | 395.93 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | [1-(3-chlorophenyl)indol-2-yl]-[4-(propan-2-ylamino)piperidin-1-yl]methanone |
| SMILES | CC(C)NC1CCN(C(=O)c2cc3ccccc3n2-c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C23H26ClN3O/c1-16(2)25-19-10-12-26(13-11-19)23(28)22-14-17-6-3-4-9-21(17)27(22)20-8-5-7-18(24)15-20/h3-9,14-16,19,25H,10-13H2,1-2H3 |
| InChIKey | HMJCRTVYJNCJTI-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.93 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |