C20H21ClN4O — CID 136537801
(5-chloro-1H-indazol-3-yl)-[4-(3-methylanilino)piperidin-1-yl]methanone (PubChem CID 136537801) has the molecular formula C20H21ClN4O and a molecular weight of 368.87 g/mol. Its IUPAC name is (5-chloro-1H-indazol-3-yl)-[4-(3-methylanilino)piperidin-1-yl]methanone.
| Compound Name | (5-chloro-1H-indazol-3-yl)-[4-(3-methylanilino)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 136537801 |
| Molecular Formula | C20H21ClN4O |
| Molecular Weight | 368.87 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | (5-chloro-1H-indazol-3-yl)-[4-(3-methylanilino)piperidin-1-yl]methanone |
| SMILES | Cc1cccc(NC2CCN(C(=O)c3n[nH]c4ccc(Cl)cc34)CC2)c1 |
| InChI | InChI=1S/C20H21ClN4O/c1-13-3-2-4-16(11-13)22-15-7-9-25(10-8-15)20(26)19-17-12-14(21)5-6-18(17)23-24-19/h2-6,11-12,15,22H,7-10H2,1H3,(H,23,24) |
| InChIKey | XBHQNSQHLGDTSU-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.87 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |