C19H23F2N3O3 — CID 134419834
3-(difluoromethyl)-5-(propylaminomethyl)-4-(2,3,4-trimethoxyphenyl)-1H-pyrrole-2-carbonitrile (PubChem CID 134419834) has the molecular formula C19H23F2N3O3 and a molecular weight of 379.41 g/mol. Its IUPAC name is 3-(difluoromethyl)-5-(propylaminomethyl)-4-(2,3,4-trimethoxyphenyl)-1H-pyrrole-2-carbonitrile.
| Compound Name | 3-(difluoromethyl)-5-(propylaminomethyl)-4-(2,3,4-trimethoxyphenyl)-1H-pyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 134419834 |
| Molecular Formula | C19H23F2N3O3 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | 3-(difluoromethyl)-5-(propylaminomethyl)-4-(2,3,4-trimethoxyphenyl)-1H-pyrrole-2-carbonitrile |
| SMILES | CCCNCc1[nH]c(C#N)c(C(F)F)c1-c1ccc(OC)c(OC)c1OC |
| InChI | InChI=1S/C19H23F2N3O3/c1-5-8-23-10-13-15(16(19(20)21)12(9-22)24-13)11-6-7-14(25-2)18(27-4)17(11)26-3/h6-7,19,23-24H,5,8,10H2,1-4H3 |
| InChIKey | PHBOVMLWGMPTNG-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 79.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|