C23H30N2O7 — CID 134419890
methyl 3-(3-methoxy-3-oxoprop-1-enyl)-5-(propylaminomethyl)-4-(2,3,4-trimethoxyphenyl)-1H-pyrrole-2-carboxylate (PubChem CID 134419890) has the molecular formula C23H30N2O7 and a molecular weight of 446.50 g/mol. Its IUPAC name is methyl 3-(3-methoxy-3-oxoprop-1-enyl)-5-(propylaminomethyl)-4-(2,3,4-trimethoxyphenyl)-1H-pyrrole-2-carboxylate.
| Compound Name | methyl 3-(3-methoxy-3-oxoprop-1-enyl)-5-(propylaminomethyl)-4-(2,3,4-trimethoxyphenyl)-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 134419890 |
| Molecular Formula | C23H30N2O7 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | methyl 3-(3-methoxy-3-oxoprop-1-enyl)-5-(propylaminomethyl)-4-(2,3,4-trimethoxyphenyl)-1H-pyrrole-2-carboxylate |
| SMILES | CCCNCc1[nH]c(C(=O)OC)c(C=CC(=O)OC)c1-c1ccc(OC)c(OC)c1OC |
| InChI | InChI=1S/C23H30N2O7/c1-7-12-24-13-16-19(15-8-10-17(28-2)22(31-5)21(15)30-4)14(9-11-18(26)29-3)20(25-16)23(27)32-6/h8-11,24-25H,7,12-13H2,1-6H3 |
| InChIKey | LCLPOOLGXVASNA-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 108.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|