C21H26N2O7 — CID 137117916
methyl 3-[cyclopropyl(hydroxy)methyl]-5-(methoxyiminomethyl)-4-(2,3,4-trimethoxyphenyl)-1H-pyrrole-2-carboxylate (PubChem CID 137117916) has the molecular formula C21H26N2O7 and a molecular weight of 418.45 g/mol. Its IUPAC name is methyl 3-[cyclopropyl(hydroxy)methyl]-5-(methoxyiminomethyl)-4-(2,3,4-trimethoxyphenyl)-1H-pyrrole-2-carboxylate.
| Compound Name | methyl 3-[cyclopropyl(hydroxy)methyl]-5-(methoxyiminomethyl)-4-(2,3,4-trimethoxyphenyl)-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 137117916 |
| Molecular Formula | C21H26N2O7 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | methyl 3-[cyclopropyl(hydroxy)methyl]-5-(methoxyiminomethyl)-4-(2,3,4-trimethoxyphenyl)-1H-pyrrole-2-carboxylate |
| SMILES | CON=Cc1[nH]c(C(=O)OC)c(C(O)C2CC2)c1-c1ccc(OC)c(OC)c1OC |
| InChI | InChI=1S/C21H26N2O7/c1-26-14-9-8-12(19(27-2)20(14)28-3)15-13(10-22-30-5)23-17(21(25)29-4)16(15)18(24)11-6-7-11/h8-11,18,23-24H,6-7H2,1-5H3 |
| InChIKey | SUORKUWHSIONJY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 111.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|