C18H20N2O7 — CID 137037401
3-acetyl-5-(methoxyiminomethyl)-4-(2,3,4-trimethoxyphenyl)-1H-pyrrole-2-carboxylic acid (PubChem CID 137037401) has the molecular formula C18H20N2O7 and a molecular weight of 376.37 g/mol. Its IUPAC name is 3-acetyl-5-(methoxyiminomethyl)-4-(2,3,4-trimethoxyphenyl)-1H-pyrrole-2-carboxylic acid.
| Compound Name | 3-acetyl-5-(methoxyiminomethyl)-4-(2,3,4-trimethoxyphenyl)-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 137037401 |
| Molecular Formula | C18H20N2O7 |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | 3-acetyl-5-(methoxyiminomethyl)-4-(2,3,4-trimethoxyphenyl)-1H-pyrrole-2-carboxylic acid |
| SMILES | CON=Cc1[nH]c(C(=O)O)c(C(C)=O)c1-c1ccc(OC)c(OC)c1OC |
| InChI | InChI=1S/C18H20N2O7/c1-9(21)13-14(11(8-19-27-5)20-15(13)18(22)23)10-6-7-12(24-2)17(26-4)16(10)25-3/h6-8,20H,1-5H3,(H,22,23) |
| InChIKey | QXCHKZUULMMOQT-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 119.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|