C13H16N3O2P — CID 134422292
benzyl [5-(ethylamino)-1H-imidazol-2-yl]phosphanylformate (PubChem CID 134422292) has the molecular formula C13H16N3O2P and a molecular weight of 277.26 g/mol. Its IUPAC name is benzyl [5-(ethylamino)-1H-imidazol-2-yl]phosphanylformate.
| Compound Name | benzyl [5-(ethylamino)-1H-imidazol-2-yl]phosphanylformate |
|---|---|
| PubChem CID | 134422292 |
| Molecular Formula | C13H16N3O2P |
| Molecular Weight | 277.26 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | benzyl [5-(ethylamino)-1H-imidazol-2-yl]phosphanylformate |
| SMILES | CCNc1cnc(PC(=O)OCc2ccccc2)[nH]1 |
| InChI | InChI=1S/C13H16N3O2P/c1-2-14-11-8-15-12(16-11)19-13(17)18-9-10-6-4-3-5-7-10/h3-8,14,19H,2,9H2,1H3,(H,15,16) |
| InChIKey | RFQZOYQMBHXRQQ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.26 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|