C16H30N2O3S — CID 134424896
tert-butyl 4-propan-2-ylsulfanyl-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate (PubChem CID 134424896) has the molecular formula C16H30N2O3S and a molecular weight of 330.49 g/mol. Its IUPAC name is tert-butyl 4-propan-2-ylsulfanyl-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate.
| Compound Name | tert-butyl 4-propan-2-ylsulfanyl-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate |
|---|---|
| PubChem CID | 134424896 |
| Molecular Formula | C16H30N2O3S |
| Molecular Weight | 330.49 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | tert-butyl 4-propan-2-ylsulfanyl-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate |
| SMILES | CC(C)SN1CCOC2(CCN(C(=O)OC(C)(C)C)CC2)C1 |
| InChI | InChI=1S/C16H30N2O3S/c1-13(2)22-18-10-11-20-16(12-18)6-8-17(9-7-16)14(19)21-15(3,4)5/h13H,6-12H2,1-5H3 |
| InChIKey | CPHVJGKSWURFSH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.49 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|