C12H22N2O3 — CID 82386799
tert-butyl 6-oxa-2,9-diazaspiro[4.5]decane-2-carboxylate (PubChem CID 82386799) has the molecular formula C12H22N2O3 and a molecular weight of 242.32 g/mol. Its IUPAC name is tert-butyl 6-oxa-2,9-diazaspiro[4.5]decane-2-carboxylate.
| Compound Name | tert-butyl 6-oxa-2,9-diazaspiro[4.5]decane-2-carboxylate |
|---|---|
| PubChem CID | 82386799 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | tert-butyl 6-oxa-2,9-diazaspiro[4.5]decane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CNCCO2)C1 |
| InChI | InChI=1S/C12H22N2O3/c1-11(2,3)17-10(15)14-6-4-12(9-14)8-13-5-7-16-12/h13H,4-9H2,1-3H3 |
| InChIKey | GEHLPPCOKTWOOG-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |