About 2,2-dimethylpentane;1-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)ethanone
2,2-dimethylpentane;1-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)ethanone (PubChem CID 145241983) has the molecular formula C17H34N2O2
and a molecular weight of 298.47 g/mol. Its IUPAC name is 2,2-dimethylpentane;1-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)ethanone.
Molecular Properties
| Compound Name | 2,2-dimethylpentane;1-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)ethanone |
| PubChem CID | 145241983 |
| Molecular Formula | C17H34N2O2 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.26 |
| IUPAC Name | 2,2-dimethylpentane;1-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)ethanone |
| SMILES | CC(=O)N1CCC2(CC1)CNCCO2.CCCC(C)(C)C |
| InChI | InChI=1S/C10H18N2O2.C7H16/c1-9(13)12-5-2-10(3-6-12)8-11-4-7-14-10;1-5-6-7(2,3)4/h11H,2-8H2,1H3;5-6H2,1-4H3 |
| InChIKey | HKJJJILVKAQNAJ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,2-dimethylpentane;1-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethylpentane;1-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)ethanone?
The IUPAC name of 2,2-dimethylpentane;1-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)ethanone (CID 145241983) is 2,2-dimethylpentane;1-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)ethanone.
What is the SMILES notation for 2,2-dimethylpentane;1-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)ethanone?
The canonical SMILES for 2,2-dimethylpentane;1-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)ethanone is CC(=O)N1CCC2(CC1)CNCCO2.CCCC(C)(C)C.
What is the InChIKey of 2,2-dimethylpentane;1-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)ethanone?
The InChIKey is HKJJJILVKAQNAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O2.C7H16/c1-9(13)12-5-2-10(3-6-12)8-11-4-7-14-10;1-5-6-7(2,3)4/h11H,2-8H2,1H3;5-6H2,1-4H3.
What are the key properties of 2,2-dimethylpentane;1-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)ethanone?
2,2-dimethylpentane;1-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)ethanone has a molecular weight of 298.47 g/mol, XLogP of 2.82, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylpentane;1-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)ethanone is sourced from PubChem (CID 145241983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).