C16H30N2O5S — CID 154907465
acetic acid;9-(thiolan-3-yl)-1-oxa-4,9-diazaspiro[5.5]undecane (PubChem CID 154907465) has the molecular formula C16H30N2O5S and a molecular weight of 362.49 g/mol. Its IUPAC name is acetic acid;9-(thiolan-3-yl)-1-oxa-4,9-diazaspiro[5.5]undecane.
| Compound Name | acetic acid;9-(thiolan-3-yl)-1-oxa-4,9-diazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 154907465 |
| Molecular Formula | C16H30N2O5S |
| Molecular Weight | 362.49 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | acetic acid;9-(thiolan-3-yl)-1-oxa-4,9-diazaspiro[5.5]undecane |
| SMILES | C1COC2(CCN(C3CCSC3)CC2)CN1.CC(=O)O.CC(=O)O |
| InChI | InChI=1S/C12H22N2OS.2C2H4O2/c1-8-16-9-11(1)14-5-2-12(3-6-14)10-13-4-7-15-12;2*1-2(3)4/h11,13H,1-10H2;2*1H3,(H,3,4) |
| InChIKey | FEAIAKYTOPICET-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.49 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |