C27H46N6O5 — CID 134427345
3-[bis[3-(prop-2-enoylamino)propyl]amino]-N-[3-[propanoyl-[3-(prop-2-enoylamino)propyl]amino]propyl]propanamide (PubChem CID 134427345) has the molecular formula C27H46N6O5 and a molecular weight of 534.70 g/mol. Its IUPAC name is 3-[bis[3-(prop-2-enoylamino)propyl]amino]-N-[3-[propanoyl-[3-(prop-2-enoylamino)propyl]amino]propyl]propanamide.
| Compound Name | 3-[bis[3-(prop-2-enoylamino)propyl]amino]-N-[3-[propanoyl-[3-(prop-2-enoylamino)propyl]amino]propyl]propanamide |
|---|---|
| PubChem CID | 134427345 |
| Molecular Formula | C27H46N6O5 |
| Molecular Weight | 534.70 g/mol |
| Exact Mass | 534.35 |
| IUPAC Name | 3-[bis[3-(prop-2-enoylamino)propyl]amino]-N-[3-[propanoyl-[3-(prop-2-enoylamino)propyl]amino]propyl]propanamide |
| SMILES | C=CC(=O)NCCCN(CCCNC(=O)C=C)CCC(=O)NCCCN(CCCNC(=O)C=C)C(=O)CC |
| InChI | InChI=1S/C27H46N6O5/c1-5-23(34)28-14-9-18-32(19-10-15-29-24(35)6-2)22-13-26(37)31-17-12-21-33(27(38)8-4)20-11-16-30-25(36)7-3/h5-7H,1-3,8-22H2,4H3,(H,28,34)(H,29,35)(H,30,36)(H,31,37) |
| InChIKey | DBRMCUOLQBOVMU-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 139.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.70 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|