C25H18F2N4O — CID 134427641
4-[[(1S)-1-[7-fluoro-2-(3-fluorophenyl)quinolin-3-yl]ethyl]amino]-8H-quinazolin-5-one (PubChem CID 134427641) has the molecular formula C25H18F2N4O and a molecular weight of 428.44 g/mol. Its IUPAC name is 4-[[(1S)-1-[7-fluoro-2-(3-fluorophenyl)quinolin-3-yl]ethyl]amino]-8H-quinazolin-5-one.
| Compound Name | 4-[[(1S)-1-[7-fluoro-2-(3-fluorophenyl)quinolin-3-yl]ethyl]amino]-8H-quinazolin-5-one |
|---|---|
| PubChem CID | 134427641 |
| Molecular Formula | C25H18F2N4O |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | 4-[[(1S)-1-[7-fluoro-2-(3-fluorophenyl)quinolin-3-yl]ethyl]amino]-8H-quinazolin-5-one |
| SMILES | C[C@H](Nc1ncnc2c1C(=O)C=CC2)c1cc2ccc(F)cc2nc1-c1cccc(F)c1 |
| InChI | InChI=1S/C25H18F2N4O/c1-14(30-25-23-20(28-13-29-25)6-3-7-22(23)32)19-11-15-8-9-18(27)12-21(15)31-24(19)16-4-2-5-17(26)10-16/h2-5,7-14H,6H2,1H3,(H,28,29,30)/t14-/m0/s1 |
| InChIKey | IGMRLQQEDLWGTI-AWEZNQCLSA-N |
| XLogP | 5.44 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |