C18H20ClF3N4O2S2 — CID 134429675
5-chloro-4-[[(1R,3R,4R,6S)-4-(dimethylamino)-7,7-difluoro-3-bicyclo[4.1.0]heptanyl]amino]-2-fluoro-N-(1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 134429675) has the molecular formula C18H20ClF3N4O2S2 and a molecular weight of 480.97 g/mol. Its IUPAC name is 5-chloro-4-[[(1R,3R,4R,6S)-4-(dimethylamino)-7,7-difluoro-3-bicyclo[4.1.0]heptanyl]amino]-2-fluoro-N-(1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 5-chloro-4-[[(1R,3R,4R,6S)-4-(dimethylamino)-7,7-difluoro-3-bicyclo[4.1.0]heptanyl]amino]-2-fluoro-N-(1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 134429675 |
| Molecular Formula | C18H20ClF3N4O2S2 |
| Molecular Weight | 480.97 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | 5-chloro-4-[[(1R,3R,4R,6S)-4-(dimethylamino)-7,7-difluoro-3-bicyclo[4.1.0]heptanyl]amino]-2-fluoro-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | CN(C)[C@@H]1C[C@H]2[C@@H](C[C@H]1Nc1cc(F)c(S(=O)(=O)Nc3nccs3)cc1Cl)C2(F)F |
| InChI | InChI=1S/C18H20ClF3N4O2S2/c1-26(2)15-6-10-9(18(10,21)22)5-14(15)24-13-8-12(20)16(7-11(13)19)30(27,28)25-17-23-3-4-29-17/h3-4,7-10,14-15,24H,5-6H2,1-2H3,(H,23,25)/t9-,10+,14-,15-/m1/s1 |
| InChIKey | RTIMNYPBTWEYOC-ANGCBRKESA-N |
| XLogP | 4.12 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.97 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |