C19H22Cl3FN4O4S2 — CID 146472180
5-chloro-4-[[(1R,3R,4R,6S)-7,7-dichloro-4-(dimethylamino)-3-bicyclo[4.1.0]heptanyl]amino]-2-fluoro-N-(1,3-thiazol-2-yl)benzenesulfonamide;formic acid (PubChem CID 146472180) has the molecular formula C19H22Cl3FN4O4S2 and a molecular weight of 559.90 g/mol. Its IUPAC name is 5-chloro-4-[[(1R,3R,4R,6S)-7,7-dichloro-4-(dimethylamino)-3-bicyclo[4.1.0]heptanyl]amino]-2-fluoro-N-(1,3-thiazol-2-yl)benzenesulfonamide;formic acid.
| Compound Name | 5-chloro-4-[[(1R,3R,4R,6S)-7,7-dichloro-4-(dimethylamino)-3-bicyclo[4.1.0]heptanyl]amino]-2-fluoro-N-(1,3-thiazol-2-yl)benzenesulfonamide;formic acid |
|---|---|
| PubChem CID | 146472180 |
| Molecular Formula | C19H22Cl3FN4O4S2 |
| Molecular Weight | 559.90 g/mol |
| Exact Mass | 558.01 |
| IUPAC Name | 5-chloro-4-[[(1R,3R,4R,6S)-7,7-dichloro-4-(dimethylamino)-3-bicyclo[4.1.0]heptanyl]amino]-2-fluoro-N-(1,3-thiazol-2-yl)benzenesulfonamide;formic acid |
| SMILES | CN(C)[C@@H]1C[C@H]2[C@@H](C[C@H]1Nc1cc(F)c(S(=O)(=O)Nc3nccs3)cc1Cl)C2(Cl)Cl.O=CO |
| InChI | InChI=1S/C18H20Cl3FN4O2S2.CH2O2/c1-26(2)15-6-10-9(18(10,20)21)5-14(15)24-13-8-12(22)16(7-11(13)19)30(27,28)25-17-23-3-4-29-17;2-1-3/h3-4,7-10,14-15,24H,5-6H2,1-2H3,(H,23,25);1H,(H,2,3)/t9-,10+,14-,15-;/m1./s1 |
| InChIKey | AEFWCFRKAHIGLL-RCFKISDBSA-N |
| XLogP | 4.36 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.90 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|