C19H26ClFN4O4S2 — CID 146472142
5-chloro-4-[[(1S,2S)-2-(dimethylamino)cycloheptyl]amino]-2-fluoro-N-(1,3-thiazol-2-yl)benzenesulfonamide;formic acid (PubChem CID 146472142) has the molecular formula C19H26ClFN4O4S2 and a molecular weight of 493.03 g/mol. Its IUPAC name is 5-chloro-4-[[(1S,2S)-2-(dimethylamino)cycloheptyl]amino]-2-fluoro-N-(1,3-thiazol-2-yl)benzenesulfonamide;formic acid.
| Compound Name | 5-chloro-4-[[(1S,2S)-2-(dimethylamino)cycloheptyl]amino]-2-fluoro-N-(1,3-thiazol-2-yl)benzenesulfonamide;formic acid |
|---|---|
| PubChem CID | 146472142 |
| Molecular Formula | C19H26ClFN4O4S2 |
| Molecular Weight | 493.03 g/mol |
| Exact Mass | 492.11 |
| IUPAC Name | 5-chloro-4-[[(1S,2S)-2-(dimethylamino)cycloheptyl]amino]-2-fluoro-N-(1,3-thiazol-2-yl)benzenesulfonamide;formic acid |
| SMILES | CN(C)[C@H]1CCCCC[C@@H]1Nc1cc(F)c(S(=O)(=O)Nc2nccs2)cc1Cl.O=CO |
| InChI | InChI=1S/C18H24ClFN4O2S2.CH2O2/c1-24(2)16-7-5-3-4-6-14(16)22-15-11-13(20)17(10-12(15)19)28(25,26)23-18-21-8-9-27-18;2-1-3/h8-11,14,16,22H,3-7H2,1-2H3,(H,21,23);1H,(H,2,3)/t14-,16-;/m0./s1 |
| InChIKey | FKZZRAZIZSZXKY-DMLYUBSXSA-N |
| XLogP | 4.11 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.03 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|