C11H19F2N — CID 134430014
4-(3,3-difluoro-2-methylpropyl)cyclohept-4-en-1-amine (PubChem CID 134430014) has the molecular formula C11H19F2N and a molecular weight of 203.28 g/mol. Its IUPAC name is 4-(3,3-difluoro-2-methylpropyl)cyclohept-4-en-1-amine.
| Compound Name | 4-(3,3-difluoro-2-methylpropyl)cyclohept-4-en-1-amine |
|---|---|
| PubChem CID | 134430014 |
| Molecular Formula | C11H19F2N |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | 4-(3,3-difluoro-2-methylpropyl)cyclohept-4-en-1-amine |
| SMILES | CC(CC1=CCCC(N)CC1)C(F)F |
| InChI | InChI=1S/C11H19F2N/c1-8(11(12)13)7-9-3-2-4-10(14)6-5-9/h3,8,10-11H,2,4-7,14H2,1H3 |
| InChIKey | GOQZFEZIZYDOPS-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|