C18H15N3O5S — CID 134433758
2-[2-[(E)-2-(5-cyano-4-oxo-2-sulfanylidene-1H-pyrimidin-6-yl)ethenyl]-6-cyclopropyloxyphenoxy]acetic acid (PubChem CID 134433758) has the molecular formula C18H15N3O5S and a molecular weight of 385.40 g/mol. Its IUPAC name is 2-[2-[(E)-2-(5-cyano-4-oxo-2-sulfanylidene-1H-pyrimidin-6-yl)ethenyl]-6-cyclopropyloxyphenoxy]acetic acid.
| Compound Name | 2-[2-[(E)-2-(5-cyano-4-oxo-2-sulfanylidene-1H-pyrimidin-6-yl)ethenyl]-6-cyclopropyloxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 134433758 |
| Molecular Formula | C18H15N3O5S |
| Molecular Weight | 385.40 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | 2-[2-[(E)-2-(5-cyano-4-oxo-2-sulfanylidene-1H-pyrimidin-6-yl)ethenyl]-6-cyclopropyloxyphenoxy]acetic acid |
| SMILES | N#Cc1c(/C=C/c2cccc(OC3CC3)c2OCC(=O)O)[nH]c(=S)[nH]c1=O |
| InChI | InChI=1S/C18H15N3O5S/c19-8-12-13(20-18(27)21-17(12)24)7-4-10-2-1-3-14(26-11-5-6-11)16(10)25-9-15(22)23/h1-4,7,11H,5-6,9H2,(H,22,23)(H2,20,21,24,27)/b7-4+ |
| InChIKey | LCLWMNSFJFEFFT-QPJJXVBHSA-N |
| XLogP | 2.48 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|