C17H15N3O5S — CID 137305420
2-[2-[(E)-2-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)ethenyl]-6-methoxyphenoxy]acetic acid (PubChem CID 137305420) has the molecular formula C17H15N3O5S and a molecular weight of 373.39 g/mol. Its IUPAC name is 2-[2-[(E)-2-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)ethenyl]-6-methoxyphenoxy]acetic acid.
| Compound Name | 2-[2-[(E)-2-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)ethenyl]-6-methoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 137305420 |
| Molecular Formula | C17H15N3O5S |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | 2-[2-[(E)-2-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)ethenyl]-6-methoxyphenoxy]acetic acid |
| SMILES | COc1cccc(/C=C/c2nc(SC)[nH]c(=O)c2C#N)c1OCC(=O)O |
| InChI | InChI=1S/C17H15N3O5S/c1-24-13-5-3-4-10(15(13)25-9-14(21)22)6-7-12-11(8-18)16(23)20-17(19-12)26-2/h3-7H,9H2,1-2H3,(H,21,22)(H,19,20,23)/b7-6+ |
| InChIKey | YQBFWNPEXKTYOQ-VOTSOKGWSA-N |
| XLogP | 2.01 |
| TPSA | 125.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|