C18H14N4O5S2 — CID 134497318
6-[2-[2-[(2,4-dioxo-1,3-thiazolidin-5-yl)methoxy]-3-methoxyphenyl]ethenyl]-4-oxo-2-sulfanylidene-1H-pyrimidine-5-carbonitrile (PubChem CID 134497318) has the molecular formula C18H14N4O5S2 and a molecular weight of 430.47 g/mol. Its IUPAC name is 6-[2-[2-[(2,4-dioxo-1,3-thiazolidin-5-yl)methoxy]-3-methoxyphenyl]ethenyl]-4-oxo-2-sulfanylidene-1H-pyrimidine-5-carbonitrile.
| Compound Name | 6-[2-[2-[(2,4-dioxo-1,3-thiazolidin-5-yl)methoxy]-3-methoxyphenyl]ethenyl]-4-oxo-2-sulfanylidene-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 134497318 |
| Molecular Formula | C18H14N4O5S2 |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.04 |
| IUPAC Name | 6-[2-[2-[(2,4-dioxo-1,3-thiazolidin-5-yl)methoxy]-3-methoxyphenyl]ethenyl]-4-oxo-2-sulfanylidene-1H-pyrimidine-5-carbonitrile |
| SMILES | COc1cccc(C=Cc2[nH]c(=S)[nH]c(=O)c2C#N)c1OCC1SC(=O)NC1=O |
| InChI | InChI=1S/C18H14N4O5S2/c1-26-12-4-2-3-9(14(12)27-8-13-16(24)22-18(25)29-13)5-6-11-10(7-19)15(23)21-17(28)20-11/h2-6,13H,8H2,1H3,(H,22,24,25)(H2,20,21,23,28) |
| InChIKey | VHXKAVJEYGQGLQ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 137.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|