C17H34N4O — CID 134434989
1-methyl-4-[(4-methylpiperazin-1-yl)methyl]-N-(2-methylpropyl)piperidine-4-carboxamide (PubChem CID 134434989) has the molecular formula C17H34N4O and a molecular weight of 310.49 g/mol. Its IUPAC name is 1-methyl-4-[(4-methylpiperazin-1-yl)methyl]-N-(2-methylpropyl)piperidine-4-carboxamide.
| Compound Name | 1-methyl-4-[(4-methylpiperazin-1-yl)methyl]-N-(2-methylpropyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 134434989 |
| Molecular Formula | C17H34N4O |
| Molecular Weight | 310.49 g/mol |
| Exact Mass | 310.27 |
| IUPAC Name | 1-methyl-4-[(4-methylpiperazin-1-yl)methyl]-N-(2-methylpropyl)piperidine-4-carboxamide |
| SMILES | CC(C)CNC(=O)C1(CN2CCN(C)CC2)CCN(C)CC1 |
| InChI | InChI=1S/C17H34N4O/c1-15(2)13-18-16(22)17(5-7-19(3)8-6-17)14-21-11-9-20(4)10-12-21/h15H,5-14H2,1-4H3,(H,18,22) |
| InChIKey | OOODVDDRTZENJY-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.49 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |