C19H37N3O3S — CID 137395437
N-(2-methylpropyl)-4-(2-morpholin-4-ylethoxymethyl)-1-(1-sulfanylethyl)piperidine-4-carboxamide (PubChem CID 137395437) has the molecular formula C19H37N3O3S and a molecular weight of 387.59 g/mol. Its IUPAC name is N-(2-methylpropyl)-4-(2-morpholin-4-ylethoxymethyl)-1-(1-sulfanylethyl)piperidine-4-carboxamide.
| Compound Name | N-(2-methylpropyl)-4-(2-morpholin-4-ylethoxymethyl)-1-(1-sulfanylethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 137395437 |
| Molecular Formula | C19H37N3O3S |
| Molecular Weight | 387.59 g/mol |
| Exact Mass | 387.26 |
| IUPAC Name | N-(2-methylpropyl)-4-(2-morpholin-4-ylethoxymethyl)-1-(1-sulfanylethyl)piperidine-4-carboxamide |
| SMILES | CC(C)CNC(=O)C1(COCCN2CCOCC2)CCN(C(C)S)CC1 |
| InChI | InChI=1S/C19H37N3O3S/c1-16(2)14-20-18(23)19(4-6-22(7-5-19)17(3)26)15-25-13-10-21-8-11-24-12-9-21/h16-17,26H,4-15H2,1-3H3,(H,20,23) |
| InChIKey | UREWXYMBDCVJTI-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.59 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|