C21H41N3O3 — CID 137395439
1-butan-2-yl-N-(2-methylpropyl)-4-(2-morpholin-4-ylethoxymethyl)piperidine-4-carboxamide (PubChem CID 137395439) has the molecular formula C21H41N3O3 and a molecular weight of 383.58 g/mol. Its IUPAC name is 1-butan-2-yl-N-(2-methylpropyl)-4-(2-morpholin-4-ylethoxymethyl)piperidine-4-carboxamide.
| Compound Name | 1-butan-2-yl-N-(2-methylpropyl)-4-(2-morpholin-4-ylethoxymethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 137395439 |
| Molecular Formula | C21H41N3O3 |
| Molecular Weight | 383.58 g/mol |
| Exact Mass | 383.31 |
| IUPAC Name | 1-butan-2-yl-N-(2-methylpropyl)-4-(2-morpholin-4-ylethoxymethyl)piperidine-4-carboxamide |
| SMILES | CCC(C)N1CCC(COCCN2CCOCC2)(C(=O)NCC(C)C)CC1 |
| InChI | InChI=1S/C21H41N3O3/c1-5-19(4)24-8-6-21(7-9-24,20(25)22-16-18(2)3)17-27-15-12-23-10-13-26-14-11-23/h18-19H,5-17H2,1-4H3,(H,22,25) |
| InChIKey | RJVSFOSLNMTCNF-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.58 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|