C25H27F3N4OS — CID 134441205
N-[4-cyano-3-(trifluoromethyl)phenyl]-2-(N-methanethioyl-4-piperidin-4-ylanilino)-N,2-dimethylpropanamide (PubChem CID 134441205) has the molecular formula C25H27F3N4OS and a molecular weight of 488.58 g/mol. Its IUPAC name is N-[4-cyano-3-(trifluoromethyl)phenyl]-2-(N-methanethioyl-4-piperidin-4-ylanilino)-N,2-dimethylpropanamide.
| Compound Name | N-[4-cyano-3-(trifluoromethyl)phenyl]-2-(N-methanethioyl-4-piperidin-4-ylanilino)-N,2-dimethylpropanamide |
|---|---|
| PubChem CID | 134441205 |
| Molecular Formula | C25H27F3N4OS |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | N-[4-cyano-3-(trifluoromethyl)phenyl]-2-(N-methanethioyl-4-piperidin-4-ylanilino)-N,2-dimethylpropanamide |
| SMILES | CN(C(=O)C(C)(C)N(C=S)c1ccc(C2CCNCC2)cc1)c1ccc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H27F3N4OS/c1-24(2,23(33)31(3)21-9-6-19(15-29)22(14-21)25(26,27)28)32(16-34)20-7-4-17(5-8-20)18-10-12-30-13-11-18/h4-9,14,16,18,30H,10-13H2,1-3H3 |
| InChIKey | VYNXDKLBNUVYST-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|