C14H23F5N2 — CID 134442061
N-(4,4-dimethylpent-1-en-2-yl)-N'-(3,3,4,4,4-pentafluorobut-1-en-2-yl)propane-1,3-diamine (PubChem CID 134442061) has the molecular formula C14H23F5N2 and a molecular weight of 314.34 g/mol. Its IUPAC name is N-(4,4-dimethylpent-1-en-2-yl)-N'-(3,3,4,4,4-pentafluorobut-1-en-2-yl)propane-1,3-diamine.
| Compound Name | N-(4,4-dimethylpent-1-en-2-yl)-N'-(3,3,4,4,4-pentafluorobut-1-en-2-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 134442061 |
| Molecular Formula | C14H23F5N2 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | N-(4,4-dimethylpent-1-en-2-yl)-N'-(3,3,4,4,4-pentafluorobut-1-en-2-yl)propane-1,3-diamine |
| SMILES | C=C(CC(C)(C)C)NCCCNC(=C)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H23F5N2/c1-10(9-12(3,4)5)20-7-6-8-21-11(2)13(15,16)14(17,18)19/h20-21H,1-2,6-9H2,3-5H3 |
| InChIKey | YUVXGFRPVOBUJL-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|