C22H25N3O3S — CID 134443237
ethoxy-[4-(4-phenoxyphenyl)-2-piperazin-1-yl-1,3-thiazol-5-yl]methanol (PubChem CID 134443237) has the molecular formula C22H25N3O3S and a molecular weight of 411.53 g/mol. Its IUPAC name is ethoxy-[4-(4-phenoxyphenyl)-2-piperazin-1-yl-1,3-thiazol-5-yl]methanol.
| Compound Name | ethoxy-[4-(4-phenoxyphenyl)-2-piperazin-1-yl-1,3-thiazol-5-yl]methanol |
|---|---|
| PubChem CID | 134443237 |
| Molecular Formula | C22H25N3O3S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | ethoxy-[4-(4-phenoxyphenyl)-2-piperazin-1-yl-1,3-thiazol-5-yl]methanol |
| SMILES | CCOC(O)c1sc(N2CCNCC2)nc1-c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C22H25N3O3S/c1-2-27-21(26)20-19(24-22(29-20)25-14-12-23-13-15-25)16-8-10-18(11-9-16)28-17-6-4-3-5-7-17/h3-11,21,23,26H,2,12-15H2,1H3 |
| InChIKey | ZOBHEKDMAWOKBK-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 66.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|