C14H19N — CID 134444218
2,6-diethyl-4-propan-2-ylbenzonitrile (PubChem CID 134444218) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is 2,6-diethyl-4-propan-2-ylbenzonitrile.
| Compound Name | 2,6-diethyl-4-propan-2-ylbenzonitrile |
|---|---|
| PubChem CID | 134444218 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 2,6-diethyl-4-propan-2-ylbenzonitrile |
| SMILES | CCc1cc(C(C)C)cc(CC)c1C#N |
| InChI | InChI=1S/C14H19N/c1-5-11-7-13(10(3)4)8-12(6-2)14(11)9-15/h7-8,10H,5-6H2,1-4H3 |
| InChIKey | UQDFRGXVXPSMEI-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |