C13H11F3O2S — CID 134444737
[4-(4-methoxyphenyl)-2-(trifluoromethyl)thiophen-3-yl]methanol (PubChem CID 134444737) has the molecular formula C13H11F3O2S and a molecular weight of 288.29 g/mol. Its IUPAC name is [4-(4-methoxyphenyl)-2-(trifluoromethyl)thiophen-3-yl]methanol.
| Compound Name | [4-(4-methoxyphenyl)-2-(trifluoromethyl)thiophen-3-yl]methanol |
|---|---|
| PubChem CID | 134444737 |
| Molecular Formula | C13H11F3O2S |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | [4-(4-methoxyphenyl)-2-(trifluoromethyl)thiophen-3-yl]methanol |
| SMILES | COc1ccc(-c2csc(C(F)(F)F)c2CO)cc1 |
| InChI | InChI=1S/C13H11F3O2S/c1-18-9-4-2-8(3-5-9)11-7-19-12(10(11)6-17)13(14,15)16/h2-5,7,17H,6H2,1H3 |
| InChIKey | FBAVLNNXPZNHSP-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.29 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |