C14H19N3O — CID 134448599
(2-methylphenyl) N-[(1E)-2-hydrazinyl-3-methylbuta-1,3-dienyl]ethanimidate (PubChem CID 134448599) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is (2-methylphenyl) N-[(1E)-2-hydrazinyl-3-methylbuta-1,3-dienyl]ethanimidate.
| Compound Name | (2-methylphenyl) N-[(1E)-2-hydrazinyl-3-methylbuta-1,3-dienyl]ethanimidate |
|---|---|
| PubChem CID | 134448599 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | (2-methylphenyl) N-[(1E)-2-hydrazinyl-3-methylbuta-1,3-dienyl]ethanimidate |
| SMILES | C=C(C)/C(=C\N=C(/C)Oc1ccccc1C)NN |
| InChI | InChI=1S/C14H19N3O/c1-10(2)13(17-15)9-16-12(4)18-14-8-6-5-7-11(14)3/h5-9,17H,1,15H2,2-4H3/b13-9+,16-12+ |
| InChIKey | PQWVEUVHQXDPIP-PWIIIKTLSA-N |
| XLogP | 2.67 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|