About (Z)-4-ethoxy-3,5-difluorooct-3-ene
(Z)-4-ethoxy-3,5-difluorooct-3-ene (PubChem CID 134449662) has the molecular formula C10H18F2O
and a molecular weight of 192.25 g/mol. Its IUPAC name is (Z)-4-ethoxy-3,5-difluorooct-3-ene.
Molecular Properties
| Compound Name | (Z)-4-ethoxy-3,5-difluorooct-3-ene |
| PubChem CID | 134449662 |
| Molecular Formula | C10H18F2O |
| Molecular Weight | 192.25 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | (Z)-4-ethoxy-3,5-difluorooct-3-ene |
| SMILES | CCCC(F)/C(OCC)=C(/F)CC |
| InChI | InChI=1S/C10H18F2O/c1-4-7-9(12)10(13-6-3)8(11)5-2/h9H,4-7H2,1-3H3/b10-8- |
| InChIKey | PFDMLVRRJCKWCH-NTMALXAHSA-N |
| XLogP | 3.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.25 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4-ethoxy-3,5-difluorooct-3-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-ethoxy-3,5-difluorooct-3-ene?
The IUPAC name of (Z)-4-ethoxy-3,5-difluorooct-3-ene (CID 134449662) is (Z)-4-ethoxy-3,5-difluorooct-3-ene.
What is the SMILES notation for (Z)-4-ethoxy-3,5-difluorooct-3-ene?
The canonical SMILES for (Z)-4-ethoxy-3,5-difluorooct-3-ene is CCCC(F)/C(OCC)=C(/F)CC.
What is the InChIKey of (Z)-4-ethoxy-3,5-difluorooct-3-ene?
The InChIKey is PFDMLVRRJCKWCH-NTMALXAHSA-N. The full InChI is InChI=1S/C10H18F2O/c1-4-7-9(12)10(13-6-3)8(11)5-2/h9H,4-7H2,1-3H3/b10-8-.
What are the key properties of (Z)-4-ethoxy-3,5-difluorooct-3-ene?
(Z)-4-ethoxy-3,5-difluorooct-3-ene has a molecular weight of 192.25 g/mol, XLogP of 3.75, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-ethoxy-3,5-difluorooct-3-ene is sourced from PubChem (CID 134449662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).